Structure 2. Models of bonding and structure
- Syllabus
- First assessment 2025
- Section
- —
- Level
- HL

Published Concept pages under this syllabus area do not have tagged past-paper appearances in the selected level yet.
Recent 5 years
Topic 2.1
| Atom tendency | Electron change | Ion formed |
|---|---|---|
| Metal atom | Loses electrons | Positive cation |
| Non-metal atom | Gains electrons | Negative anion |
Use the electron configuration to see how many electrons are needed to reach the relevant stable arrangement. The number lost or gained determines the magnitude of the ion charge.
Loss of electrons leaves more protons than electrons and gives a positive charge. Gain of electrons gives more electrons than protons and gives a negative charge.
Read the outer-shell electrons before predicting charge: Al loses three electrons to form Al³⁺, while O gains two to form O²⁻. Check the sign by recounting protons and electrons after transfer; do not assume that every metal, especially a transition metal, has only one possible charge.
Questions ask how many electrons an atom gains or loses or how a metal forms its stable ion.
determine
Read the configuration or metal identity, choose electron gain or loss, and match the number of electrons to the resulting ion charge.
Reversing gain and loss or giving the magnitude of charge with the wrong sign.
Representative question
How many electrons will be gained or lost when the element with electron configuration 1s22s22p3 forms an ionic bond?
Two electrons lost
Two electrons gained
Three electrons lost
Three electrons gained
D
Ionic bonding is the electrostatic attraction between oppositely charged cations and anions. Electron transfer can create the ions, but it is not by itself the definition of the bond.
| Task | Check |
|---|---|
| Formula | Choose subscripts so total positive and negative charge is zero |
| Name | State the cation first, then the anion; binary anions use the -ide ending |
| Polyatomic ion | Keep the ion together and use brackets when more than one is needed |
For a metal ion and a polyatomic ion, balance the charges rather than copying the numerical charge into a subscript without checking the whole formula.
Balance total charge, not ion numbers. Al³⁺ and O²⁻ require 2(+3) + 3(−2) = 0, giving Al₂O₃; Ca²⁺ and NO₃⁻ give Ca(NO₃)₂. These formulae state the simplest ion ratio in a lattice, not the composition of one molecule.
Questions ask learners to describe ionic bonding or write a neutral formula for a named ionic compound with a polyatomic ion.
describe / write
State electrostatic attraction between oppositely charged ions, and balance the cation and anion charges to produce the complete formula.
Writing only electron transfer for the bonding description, or failing to use brackets and charge balance for a polyatomic ion.
Representative question
Describe the two types of bonding.
lonic bonding:
Covalent bonding:
Ionic bonding: electrostatic attraction between oppositely charged ions/cations AND anions
Covalent bonding: electrostatic attraction between shared electron pair and positively charged nuclei
Marking guidance:
Do not accept answers referring to transfer of electrons for M1.
Penalize missing "electrostatic attraction once only.
An ionic lattice is a three-dimensional, repeating arrangement of cations and anions. Its empirical formula gives the simplest whole-number ion ratio, not a molecule.
Lattice dissociation enthalpy is the positive enthalpy change for separating one mole of a solid lattice into gaseous ions. It becomes larger when ionic charges are higher or ionic radii are smaller, because the electrostatic attraction is stronger.
| Property | Structure-based explanation |
|---|---|
| High melting point / low volatility | Strong electrostatic attractions act throughout the lattice |
| Brittle | A layer shift can bring like charges together, causing repulsion and fracture |
| Solid conductivity | Ions are fixed and cannot carry charge through the solid |
| Molten/aqueous conductivity | Ions are mobile and can carry charge |
| Solubility | Depends on the balance between lattice attraction and ion–solvent attraction |
Use charge density to compare lattice strength: MgO has stronger attractions than NaCl because both ions carry ±2 rather than ±1, so its melting point is higher. For conductivity, the presence of charged particles is not enough—solid NaCl does not conduct until its ions can move. Water often hydrates ions, but solubility still depends on the energy balance rather than on polarity alone.
Questions describe ionic bonding in a lattice or compare conductivity of a solid ionic compound with a metal.
describe / explain
Refer to electrostatic attraction or the lattice, then explain ion fixation in a solid or ion mobility in a molten/dissolved state.
Saying only that a compound is ionic without linking the requested property to lattice structure and particle mobility.
Representative question
Predict, with a reason, the electrical conductivity of K(s) and KCl(s).
K(s):
KCl(s) :
K( s) :
high «electrical conductivity»/conductor AND electrons free to flow/delocalized
KCl(s):
low «electrical conductivity»/not a conductor AND ions/charged particles are fixed in position
Marking guidance:
Award [1 max] for K(s) is a conductor AND KCl(s) is not a conductor.
Do not accept just "metal" or "metallic bonding" for M1.
Do not accept an explanation in terms of electrons for M2.
Retrieve the chain: atoms gain or lose electrons to form ions; oppositely charged ions attract and balance into empirical formulae; the three-dimensional lattice explains volatility, solubility, and conductivity.
When checking an answer, ask: Did I state gain or loss and charge? Did I define the bond as electrostatic attraction? Did I connect the property to lattice arrangement and ion mobility?
Topic 2.2
A covalent bond is the electrostatic attraction between a shared electron pair and the nuclei of the bonded atoms. Lewis formulas show valence electrons and shared pairs.
Use the octet tendency to place shared and lone pairs, while remembering that the assessed Lewis scope allows up to four electron pairs around an atom.
Build a Lewis formula by counting all valence electrons, choosing a skeleton, completing outer octets and placing any remainder on the central atom. Then recount electrons and formal charge; a shared pair contributes to the attraction between both nuclei rather than belonging exclusively to either atom.
Charged-species check: NH₄⁺ has 5 + 4(1) − 1 = 8 valence electrons, so draw four N–H shared pairs, no lone pair on N, enclose the ion in brackets and write the overall + charge. A final audit must match the available electron total, complete the required outer-shell arrangements and reproduce the species charge; lone pairs, shared pairs and formal charges answer different parts of that audit.
Representative question
Draw the Lewis formula of the HCN molecule.
Hx˙CxxxxxN:N:
Accept any combination of dots or
crosses to represent electrons, or
lines to represent electron pairs.
| Bond | Shared pairs | Relative length and strength |
|---|---|---|
| Single | 1 | Longest and weakest of the three |
| Double | 2 | Shorter and stronger |
| Triple | 3 | Shortest and strongest |
More shared electron pairs increase electron density between nuclei, so the bond becomes shorter and stronger.
For the same pair of atoms, increasing bond order generally shortens and strengthens the bond because more electron density lies between the nuclei. Use that comparison locally: bond enthalpy also depends on the atoms and molecular environment, so any triple bond is not automatically stronger than every unrelated single bond.
Representative question
Compare, giving a reason, the length of the bond between the carbon atoms in ethyne with that in ethane, C2H6.
«ethyne» shorter AND a greater number of shared/bonding electrons OR
«ethyne» shorter AND stronger bond
In a coordination bond, both electrons in the shared pair come from the same atom. The bond can be represented by an arrow from the electron-pair donor to the acceptor.
Identify the donor atom or ligand and the acceptor, including coordination bonds in transition-element complexes at HL.
In NH₃→BF₃ the nitrogen lone pair supplies both bonding electrons, so the arrow starts at N and ends at B. The arrow records how the pair originated; after formation it is a shared covalent pair, and in a complex the same donor logic identifies each ligand–metal bond.
Representative question
State the precise type of bond formation between the cyanide ion and the iron ion.
bond
coordination
Marking guidance:
Accept dative/coordination
covalent.
VSEPR predicts molecular shape by arranging electron domains around a central atom to minimize repulsion. Lone pairs repel more strongly than bonding pairs and therefore alter common bond angles.
| Step | Decision |
|---|---|
| 1 | Count bonding and lone-pair electron domains |
| 2 | Assign electron-domain geometry |
| 3 | Ignore lone pairs when naming molecular geometry |
| 4 | Adjust expected bond angles for lone-pair repulsion |
NH₃ has four electron domains around N, so its electron-domain geometry is tetrahedral but its molecular shape is trigonal pyramidal; the lone pair compresses the H–N–H angle below 109.5°. Count a double bond as one domain and distinguish electron geometry from the shape named using atoms only.
Representative question
Deduce the electron domain geometry and molecular geometry of SO2.
Electron domain geometry:
Molecular domain geometry:
Electron domain geometry: trigonal planar
Molecular domain geometry: bent / V-shaped / angular
Apply ECF from Lewis formula.
A bond is polar when a difference in electronegativity gives unequal sharing of the bonding electrons. The more electronegative atom carries partial negative character.
Compare electronegativities, assign partial charges, and draw the bond-dipole arrow toward the more electronegative atom.
For H–Cl, chlorine is more electronegative, so label Hδ⁺–Clδ⁻ and point the dipole arrow toward Cl. Electronegativity difference predicts unequal sharing within that bond; it does not by itself decide the polarity of the whole molecule.
Representative question
Describe the nature of the bond between oxygen and phosphorus. Use sections 9 and 17 of the data booklet.
" 3.4−2.2=1.2,(3.4+2.2)/2=2.8 "
Electronegativity difference is 1.2 .
AND
Average electronegativity is 2.8
polar covalent
Molecular polarity depends on both the polarity of individual bonds and the three-dimensional geometry of the molecule or ion. Bond dipoles can cancel or produce a net dipole moment.
Draw or infer the geometry, place each bond dipole, and check whether the vector sum is zero. Do not decide molecular polarity from a single bond alone.
CO₂ contains polar C=O bonds, but their equal opposite dipoles cancel in a linear molecule. In bent H₂O they do not cancel, so the molecule has a net dipole. Always establish the three-dimensional geometry before adding dipoles as vectors.
Representative question
Explain the polarity of the SO2 molecule.
«both» bonds are polar / electronegativity difference «between O and S»
«bond» dipoles do not cancel each other / there is a net dipole «because bonds are at an angle less than 180∘ »
Marking guidance:
Accept unsymmetrical distribution of charge OR dipoles add to give a «partial» positive «charge» on S and a «partial» negative «charge» on the O atoms for M2.
Apply ECF from molecular geometry.
| Material | Structural evidence | Property or use explained |
|---|---|---|
| Diamond | each C covalently bonded in a rigid 3D network | very hard; high melting point; no mobile charge carriers |
| Graphite | strong covalent sheets with delocalized electrons; weak attractions between sheets | conducts along sheets; layers slide, so it is soft/lubricating |
| Graphene | one atom-thick covalent sheet with delocalized electrons | strong, light and electrically conducting |
| Fullerenes | finite carbon cages or tubes rather than an infinite 3D network | molecular shape and intermolecular contacts give properties distinct from diamond/graphite |
| Silicon | extended covalent structure with limited charge mobility | semiconductor behaviour; detailed doping is outside this card |
| Silicon dioxide | 3D Si–O covalent network, not discrete SiO₂ molecules | hard and high-melting because many strong covalent bonds must be overcome |
Decide conductivity by available mobile charges, not by the word covalent alone.
Explain a network material property by connecting the structure and bonding arrangement to the relevant mobility, strength, or dimensional feature.
Diamond is hard because each carbon is held in a three-dimensional covalent network, while graphite conducts along layers through delocalized electrons and its layers can slide. Silicon dioxide is also an extended network: describe network atoms, not discrete SiO₂ molecules, when explaining its high melting point.
Representative question
Identify three allotropes of carbon and describe their structures.
Allotropes:
diamond
graphite
fullerene
graphene;
Structures:
Diamond:
tetrahedral arrangement of (carbon) atoms/each carbon bonded to four others / sp3 and 3D/covalent network structure;
Graphite:
each carbon bonded to three others (in a trigonal planar arrangement) / sp2 and 2D / layers of (carbon) atoms;
Fullerene:
each (carbon) atom bonded to three others (in a trigonal arrangement) / sp2 and joined in a ball/cage/sphere/connected hexagons and pentagons;
Graphene:
each carbon bonded to three others (in a trigonal arrangement) / sp2 and 2D structure;
| Force | Evidence used to identify it |
|---|---|
| London dispersion | Present; increases with molecular size and electron count |
| Dipole-induced dipole | A permanent dipole induces a dipole in a neighbour |
| Dipole-dipole | Permanent dipoles attract |
| Hydrogen bonding | Hydrogen bonded to a strongly electronegative atom creates the required interaction |
Start with molecular size and polarity, then check for the structural requirement for hydrogen bonding. More than one IMF can be present.
All molecules have London dispersion forces. Add permanent dipole–dipole attraction when a net molecular dipole exists, and add hydrogen bonding only when the required H–N, H–O or H–F environment and an acceptor lone pair are present. Name every relevant force before deciding which dominates.
Representative question
Outline how a hydrogen bond is formed.
H that is «covalently» bonded to a «highly» electronegative atom
is attracted to the electronegative atom of neighbouring molecule
Marking guidance:
Accept a labelled diagram for both marks.
Accept "F, O or N" for "electronegative atom".
For the relative comparison in this topic, London dispersion forces are weaker than dipole-dipole forces, which are weaker than hydrogen bonding. Molecular size also affects dispersion strength.
Stronger intermolecular attractions generally reduce volatility. Explain conductivity and solubility by considering whether charged particles are available and whether solute–solvent attractions are favourable.
Compare like evidence: pentane has stronger dispersion forces and a higher boiling point than butane because its electron cloud is larger. The simple London < dipole–dipole < hydrogen-bond ordering is a guide for comparable molecules, not a rule that ignores molecular size and the number of interaction sites.
Representative question
Explain, in terms of the intermolecular forces present, the trend in the boiling points of the first four alkenes.
| Alkene | Boiling point / K |
|---|---|
| ethene | 169 |
| propene | 225 |
| but-1-ene | 267 |
| pent-1-ene | 303 |
London (dispersion) forces «only»
stronger forces of attraction with increasing chain length / larger electron cloud /molar mass
Marking guidance:
Accept dispersion forces/ instantaneous / transient / induced dipole attractions for M1. Do not accept van der Waals' forces for M1.
Accept "more electrons" for "larger electron cloud" in M2.
Accept increased surface area.
Chromatography separates components because they have different attractions to the stationary and mobile phases. A component that is more strongly attracted to the mobile phase travels farther.
Rf=distancetravelledbycomponent/distancetravelledbysolventfront
Rf is a dimensionless ratio of distances measured from the same origin under the same conditions. Because a component cannot pass the solvent front, a valid result lies from 0 to 1; a value above 1 signals a distance or origin error. Operational details beyond the separation principle are not assessed here.
If a spot moves 3.2 cm while the solvent front moves 8.0 cm, Rf = 0.40. A larger Rf means greater relative affinity for the mobile phase under those conditions, but values from different solvents, stationary phases or temperatures are not directly interchangeable.
Representative question
Explain how the separation of inks is achieved using paper chromatography.
«inks» have different attraction to mobile phase AND stationary phase OR
«inks» separated based on solubilities in/affinities to the two phases OR
separations based on polarities/polar attractions
continuous cycle of adsorption and desorption/dissolution
OR
ink/sample/solute moves when in solvent AND does not move when on paper
Marking guidance:
Allow answers in terms of an equilibrium/partitioning for M1.
Resonance structures represent alternative valid positions for multiple bonds while preserving the atom framework. The actual bonding is described using delocalized electrons, not a molecule switching between drawings.
Keep atom connectivity and total electrons consistent, draw each valid arrangement, and use delocalization to describe the shared bonding picture.
For CO₃²⁻, place the C=O bond in each of three valid positions while keeping atom positions and total charge fixed. The observed C–O bonds are equivalent because the π electrons are delocalized; the ion does not alternate among three localized structures.
Representative question
Predict, with a reason, the bond lengths of the nitrate ion. Use section 11 of the data booklet.
124 «x 10−12 m »
delocalized electrons / resonance structure
Accept any length between 115 « x10−12m » and 135 « 10−12m » for M1.
Accept 'intermediate between single and double', or 'bond order greater than 1 but less than 2' for M2.
Question
Answers
Notes
Total
Benzene is an important resonance example: alternative ring structures place the double bonds in different positions, while the actual π electrons are delocalized across the ring.
Use the resonance drawings as representations of one delocalized bonding system, not as separate rapidly changing molecular forms.
Benzene's six equal C–C bonds and greater stability than a localized triene support a delocalized π system above and below the ring. Use the two Kekulé drawings or a circle as representations of the same molecule, never as an equilibrium between two species.
Representative question
The Styrene molecule is a derivative of benzene.
State both a chemical and physical reason structure A is a better representation of benzene.
Chemical reason:
Physical reason:
Chemical reason: Any one of: does not «easily» undergo «electrophilic» addition.
OR undergoes electrophilic substitution reactions.
OR enthalpy of hydrogenation is not 3 x that of cyclohexene/ less exothermic than 3 x that of cyclohexene.
OR all «C-C» bond energies are the same.
Physical reason: Any one of: all bond lengths are the same.
OR
all bond angles are the same / molecule is planar.
Marking guidance:
Award [1 max] for each property.
Award [1 max] if properties are reversed.
Some HL species have five or six electron domains around a central atom. Draw the Lewis formula, count the domains, and apply VSEPR to assign the corresponding geometry.
For five domains, start from trigonal-bipyramidal electron geometry; lone pairs prefer equatorial positions because that reduces 90° interactions, producing common shapes such as seesaw and T-shaped. For six domains, start from octahedral geometry; removing one or two lone-pair positions gives common square-pyramidal or square-planar molecular shapes. Name molecular shape from atom positions after the electron-domain arrangement is fixed.
Five bonding domains give trigonal-bipyramidal PCl₅ and six give octahedral SF₆. If lone pairs are present, keep the electron-domain arrangement but remove lone-pair positions when naming molecular shape, choosing positions that minimize the strongest repulsions.
Representative question
Deduce the molecular geometry of PCl3 and PCl5.
PCl3:
PCl5 :
PCl3. trigonal pyramid PCl5. trigonal bipyramid
formalcharge=valenceelectrons−non−bondingelectrons−1/2(bondingelectrons)
Calculate formal charges for each valid Lewis structure, then compare the charge distribution when choosing a preferred representation. Preserve the total charge of the species.
After calculating every atom, verify that formal charges sum to the overall species charge. Prefer a valid structure that minimizes charge magnitude and separation, placing negative formal charge on the more electronegative atom when other evidence is comparable; formal charge is bookkeeping, not measured partial charge.
Representative question
Outline, in terms of formal charge, why Lewis formula 2 is preferred.
Lewis formula 1: O-1 AND P+1 «are the only formal charges»
Lewis formula 2: formal charges zero/closest to zero «and hence preferred»
Accept labelling for M1:
| Bond type | Orbital combination | Electron density |
|---|---|---|
| σ | Head-on overlap | Along the bond axis |
| π | Lateral p-orbital overlap | On opposite sides of the bond axis |
A multiple bond contains one sigma bond plus one or more pi bonds. Use the overlap and density location to distinguish the two.
Ethene contains five σ bonds—four C–H and one C–C—and one π bond; ethyne contains three σ and two π bonds. The σ framework fixes the bond axis, while sideways p-orbital overlap creates π density and restricts rotation about a double bond.
Representative question
Describe how sigma ( σ ) and pi ( π ) bonds are formed.
σ bonds:
π bonds:
σ bonds:
orbital overlap/high electron density along internuclear axis/between nuclei
OR
head-on/end-to-end overlap «of atomic/hybridized orbitals»
π bonds:
«orbital» overlap/high electron density above and below internuclear/bond axis
OR
sideways overlap «of parallel p orbitals»
Marking guidance:
Award [2 max] for appropriate
diagrams.
Hybridization analysis follows a chain: Lewis formula → electron domains → geometry → hybrid orbital description. It describes mixing atomic orbitals to form hybrid orbitals used in bonding.
Count the electron domains around the relevant atom, identify the geometry, then assign the corresponding hybridization description for the molecule or ion.
Treat each single, double or triple bond as one electron domain. Four domains map to sp³, three to sp² and two to sp; thus methane carbon is sp³, each ethene carbon sp² and each ethyne carbon sp. Hybridization follows the Lewis/VSEPR model rather than replacing it.
Representative question
Deduce the hybridization of the carbon atom and the number of sigma and pi bonds that it forms.
Hybridization:
Sigma bonds:
Pi bonds:
Hybridization: sp
Sigma bonds: 2 AND Pi bonds: 2
Retrieve the covalent pathway: shared pairs and bond order lead to geometry, polarity and molecular polarity; structure determines network properties, IMF behaviour and chromatography; HL representations extend to resonance, formal charge, sigma/pi bonds and hybridization.
Check the representation first, then count domains, apply geometry, identify polarity or forces, and connect the structure to the requested property or HL bonding description.
Topic 2.3
Metallic bonding is the electrostatic attraction between a lattice of positive metal ions and delocalized electrons.
Delocalized electrons can move through the structure and carry charge and thermal energy. Non-directional attraction allows layers of cations to slide while the bonding remains.
When a potential difference is applied, delocalized electrons drift through the fixed cation lattice and carry charge; the positive ions do not travel through the metal. When layers shift under force, non-directional attraction to the electron sea persists, explaining malleability rather than brittle fracture.
Property-to-use link: copper is used for electrical wiring because its delocalized electrons carry charge through the solid; aluminium can be rolled into foil because ion layers can shift while non-directional metallic attraction is maintained. A use must be justified by the relevant property, not merely by stating that the substance is a metal.
Representative question
Describe metallic bonding and how it contributes to electrical conductivity.
electrostatic attraction
between «a lattice of» cations/positive «metal» ions AND «a sea of» delocalized electrons
mobile electrons responsible for conductivity
OR
electrons move when a voltage/potential difference/electric field is applied
Marking guidance:
Do not accept "nuclei" for "cations/positive ions" in M2.
Accept "mobile/free" for "delocalized" electrons in M2.
Accept "electrons move when connected to a cell/battery/power supply" OR "electrons move when connected in a circuit" for M3.
Metallic-bond strength depends on the attraction between metal ions and delocalized electrons. Ion charge, ion radius, and the number of delocalized electrons affect charge density and attraction.
A larger ion radius generally lowers attraction; greater charge or more delocalized electrons can strengthen metallic bonding. Use the stated comparison rather than a memorized trend alone.
Compare Na and Mg using the model: Mg supplies more delocalized electrons and forms smaller, more highly charged ions, giving stronger attraction and a higher melting point. State all relevant factors before predicting; across broader sets, lattice structure can prevent a perfectly smooth trend.
Representative question
Explain why the melting points of the group 1 metals (Li→Cs) decrease down the group.
2.
b
atomic/ionic radius increases
smaller charge density
OR
force of attraction between metal ions and delocalised electrons decreases
Marking guidance:
Do not accept discussion of attraction between valence electrons and nucleus for M2.
Accept "weaker metallic bonds" for M2.
Transition elements have delocalized d electrons as well as s electrons in their metallic structure. These mobile electrons are attracted to a lattice of positive metal ions.
More delocalized electrons can strengthen the electrostatic attraction, so substantial energy is often needed to disrupt the lattice, helping to explain high melting points. The same mobile electrons carry charge through the solid, explaining electrical conductivity.
Use this as a causal model, not a universal ranking: electron contribution, ion radius and crystal structure vary across the transition series, so melting points need not form a perfectly smooth trend. The chemical reactions of transition elements belong to Reactivity 3.4, not this card.
Representative question
Suggest why the melting point of vanadium is higher than that of titanium.
vanadium has smaller ionic radius «leading to stronger metallic bonding»
Accept vanadium has «one» more valence electron«s» «leading to stronger metallic bonding». Accept "atomic" for "ionic".
Retrieve the model: positive ions attract delocalized electrons; electron mobility explains conductivity and non-directional bonding explains malleability; charge, radius, and d-electron contribution explain strength trends.
A complete property explanation should name the cation lattice, delocalized electrons, and the specific structural change relevant to the property.
Topic 2.4
Ionic, covalent, and metallic bonding are models whose contributions can vary across materials. The bonding continuum represents mixed character rather than completely separate categories.
Use the relative contributions of the three bonding types to explain a material's position and its likely properties.
Treat the three bonding models as coordinates rather than sealed boxes. A material may combine electron sharing with partial charge separation, so its properties can fall between idealized categories. Explain which model contribution accounts for each observed property instead of assigning one label and stopping.
Representative question
State the types of bonding in magnesium, oxygen and magnesium oxide, and how the valence electrons produce these types of bonding.
| Substance | Bond type | How the valence electrons produce these bonds |
|---|---|---|
| Magnesium | .......... | □ ________ |
| Oxygen | .......... | ____ □ |
| Magnesium oxide | .......... | ____ |
Substance
Bond type
How the valence electrons produce these bonds
Marking guidance:
Award [1] for all bonding types correct.
Award [1] for each correct description.
Apply ECF for M2 only once.
delocalized «throughout
lattice attracted to
cations»
Accept reference to "sea"/flux of electrons
«attracted to cations»
Oxygen
covalent
shared «between
Magnesium oxide
ionic
transferred «from magnesium to oxygen» OR
lost by magnesium AND gained by oxygen
The bonding triangle is a model for mixed ionic, covalent and metallic character. Its horizontal coordinate uses average electronegativity and its vertical coordinate uses electronegativity difference.
Calculate the two coordinates from the supplied electronegativities, place the substance, then check whether the predicted properties fit the indicated bonding contribution. The triangle is a qualitative model, not a requirement to memorise percentage boundaries.
For NaCl, using χ(Na)=0.9 and χ(Cl)=3.2 gives average χ = (0.9+3.2)/2 = 2.05 and Δχ = 3.2−0.9 = 2.3. The large difference places it near the ionic apex; that placement is consistent with a high-melting lattice and conduction only when ions can move.
Use the coordinates to compare materials rather than treating labels as absolute. A small Δχ can still sit at different average electronegativities, so metallic versus covalent character depends on both axes. Test the interpretation against conductivity, melting behaviour and mechanical response.
Representative question
Deduce, showing your working, the type of bonding and percentage covalent character in calcium bromide, CaBr2. Use sections 9 and 17 of the data booklet.
«electronegativity difference => 2.0 AND «average electronegativity => 2.0
ionic AND 35\% covalent
Marking guidance:
Accept range 30-40\% for percentage
covalent character.
An alloy is a mixture containing a metal and one or more other metals or non-metals. Different-sized atoms disrupt the regular lattice, making layer sliding more difficult while non-directional metallic bonding remains.
Explain an alloy property by referring to composition, lattice disruption, and the restricted movement of layers; do not call the alloy a compound.
In brass, differently sized Cu and Zn atoms disturb regular layer alignment, so dislocations move less easily and the alloy can be harder than pure copper. Material choice still involves trade-offs—an alloy may gain strength while losing ductility or conductivity—and its variable composition confirms that it is a mixture.
Representative question
Explain why metals alloyed with another metal are usually harder and stronger but poorer conductors than the pure metal.
metal ions/atoms have different sizes cations/atoms/layers do not slide over each other as easily «irregularities» obstruct free movement of electrons
Marking guidance:
Accept electrons move less easily/less delocalized for M3.
A polymer is a macromolecule built from repeating monomer-derived units. Chain structure and cross-links influence plastic properties.
| Chain feature | Molecular-motion or packing effect | Typical qualitative consequence |
|---|---|---|
| Long, relatively linear chains | can pack more closely when chain chemistry permits | stronger intermolecular contact and often greater strength/density |
| More branching | can hinder close, regular packing | often lowers packing efficiency and can increase flexibility |
| Few/no cross-links | chains can move past one another more readily on heating | thermoplastic softening and reshaping |
| Dense cross-linking | strongly restricts chain movement | rigid thermoset behaviour; does not simply melt and reshape |
These are conditional structure–property trends: functional groups, chain length and processing history also matter.
Compare chain mobility: weakly interacting, unlinked chains can soften and be reshaped, whereas extensive cross-linking restricts movement and gives thermoset behaviour. A useful structure–property explanation names the repeat-chain feature, the permitted molecular motion and the resulting macroscopic response.
Cellulose is a natural polymer, whereas polyethene is synthetic. Both are macromolecules with repeating units, but origin alone does not determine a plastic's properties or biodegradability: chain structure, functional groups, intermolecular attractions, branching and cross-linking control packing and molecular motion.
Representative question
Contrast the physical properties of polymers with extensive covalently bonded cross-links to polymers which only have a few of these links, giving an example of each.
| Physical properties | Example | |
|---|---|---|
| Extensive covalent cross-links: | ________________ | □ ____________ |
| Few covalent cross-links: | ________ □ | □ |
i
Example
Accept any correct example. eg. billiard balls for thermoset.
Accept "resins" for thermoset.
Accept other valid examples.
Accept "polyester" for either thermoset or thermoplastic for both.
Do not accept same physical property argument for both eg. higher mp for thermoset, lower mp for thermoplastics.
«thermoset»
Bakelite/HDPE/epoxies/
polyurethane
Few covalent
cross-links:
flexible/able to return to shape/can be
recycled
«thermoplastics» rubber/PVC/polystyrene/nylon/ polypropene/polyethene
Addition polymerization forms a chain by opening the monomer C=C bond. The substituents remain attached to the backbone carbons and continuation bonds show the repeating unit extends.
Remove the double bond in the monomer, preserve every substituent, and draw bonds out of the repeating unit at both ends.
Propene forms the repeat unit [–CH₂–CH(CH₃)–]ₙ: open the C=C, keep CH₃ on the same backbone carbon and draw continuation bonds through the brackets. No small molecule is eliminated, so atom accounting should match the monomer exactly.
Representative question
Styrene can undergo polymerization.
Draw the structure of the polymer chain. Show three repeating units and state the type of polymerization that occurs.
Type of polymerization:
correct structure
AND
continuation bonds shown
addition «polymerisation»
Accept either structure for the benzene ring.
Accept phenyl rings on either side of the polymer backbone
Condensation polymerization joins difunctional monomers and releases a small molecule. Polyamides and polyesters form through the corresponding functional-group linkages.
Use both functional groups to connect the monomers, show continuation bonds, and account for the eliminated small molecule. A diol plus dicarboxylic acid forms ester links; a diamine plus dicarboxylic acid forms amide links, –CO–NH–, with water eliminated. Check that the repeat unit contains residues from both monomers, that no unreacted end group is trapped inside the repeat, and that the linkage plus by-product conserves every atom.
For a diol and a dicarboxylic acid, join –OH and –COOH groups to make ester links and release water at each new link. The repeat unit must contain residues from both monomers with continuation bonds through the functional links; do not leave unreacted end groups inside the repeat.
Representative question
Nylon 6,6 is formed by condensation polymerisation.
Deduce the structures of the two monomers that form the polyamide nylon 6,6.
H2 N(CH2)6NH2HOOC(CH2)4COOH/ClOC(CH2)4COCl
Marking guidance:
Accept any type of structural or skeletal formula.
Penalize clear incorrect bond connections only once in the paper.
Retrieve the pathway: locate bonding contributions, connect them to material properties, distinguish alloy lattice disruption, and construct addition or condensation polymer repeating units from monomer evidence.
Check that the bonding description matches the material, the property explanation names the structural cause, and every polymer substituent, continuation bond, and released small molecule is represented.